CAS 201984-32-9 appears in our catalog under these names: H-D-Ala-betaNA · HCl, H-D-Ala-bNA·HCl. Offered by: Creative Peptides, Biosynth. Available pack sizes: 1g, 5g, 5000mg, 2000mg, 10000mg.
(2R)-2-amino-N-naphthalen-2-ylpropanamide;hydrochloride (CAS 201984-32-9) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 250.72 g/mol. IUPAC name: (2R)-2-amino-N-naphthalen-2-ylpropanamide;hydrochloride. InChIKey: WNLRRMRLNYQNOZ-SBSPUUFOSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | (2R)-2-amino-N-naphthalen-2-ylpropanamide;hydrochloride |
| InChIKey | WNLRRMRLNYQNOZ-SBSPUUFOSA-N |
| SMILES | C[C@H](C(=O)NC1=CC2=CC=CC=C2C=C1)N.Cl |
Computed by PubChem (NCBI)