Products 2020070-00-0
CAS 2020070-00-0 is the registry number for 3-{1-[(tert-butoxy)carbonyl]piperidin-4-yl}bicyclo[1.1.1]pentane-1-carboxylic acid, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g.
3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2020070-00-0) is a chemical compound with the molecular formula C16H25NO4 and a molecular weight of 295.37 g/mol. IUPAC name: 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: LKGBJQWYSKVMKC-UHFFFAOYSA-N.
| Molecular formula | C16H25NO4 |
|---|---|
| Molecular weight | 295.37 g/mol |
| IUPAC name | 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | LKGBJQWYSKVMKC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C23CC(C2)(C3)C(=O)O |
Computed by PubChem (NCBI)