Products 2022122-27-4
CAS 2022122-27-4 is the registry number for 1-(2,3-Dihydrothieno[3,4-b]-1,4-dioxin-5-yl)-2-methyl-1-propanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-methylpropan-1-one (CAS 2022122-27-4) is a chemical compound with the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. IUPAC name: 1-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-methylpropan-1-one. InChIKey: POSVTAYVPWYRJA-UHFFFAOYSA-N.
| Molecular formula | C10H12O3S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 1-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-methylpropan-1-one |
| InChIKey | POSVTAYVPWYRJA-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=C2C(=CS1)OCCO2 |
Computed by PubChem (NCBI)