CAS 3842-25-9 appears in our catalog under these names: L–Aspartic acid–d3, L-Aspartic-2,3,3-d3 Acid, L-Aspartic Acid-d3, >95% (HPLC), L-Aspartic-2,3,3-d3 Acid, 98 atom % D, min 98% Chemical Purity, L-Aspartic acid-d3, 99.9%. Offered by: GLPBio, Chemat Brand, TRC, CDN, MedChemExpress. Available pack sizes: 25mg, on request, 100mg, 10mg, 50mg, 0,25g, 0,1g, 5mg.
(2S)-2-amino-2,3,3-trideuteriobutanedioic acid (CAS 3842-25-9) is a chemical compound with the molecular formula C4H7NO4 and a molecular weight of 136.12 g/mol. IUPAC name: (2S)-2-amino-2,3,3-trideuteriobutanedioic acid. InChIKey: CKLJMWTZIZZHCS-RBXBQAPRSA-N.
| Molecular formula | C4H7NO4 |
|---|---|
| Molecular weight | 136.12 g/mol |
| IUPAC name | (2S)-2-amino-2,3,3-trideuteriobutanedioic acid |
| InChIKey | CKLJMWTZIZZHCS-RBXBQAPRSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C(=O)O)N |
Computed by PubChem (NCBI)