Products 202468-47-1
CAS 202468-47-1 appears in our catalog under these names: L–Methionine–13C5,15N, L-Methionine-13C5,15N, 99%, 99%, L-Methionine-13C5,15N, 99.20%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 50mg, 1 mg, 10 mg, 5 mg.
(2S)-2-(15N)azanyl-4-(113C)methylsulfanyl(1,2,3,4-13C4)butanoic acid (CAS 202468-47-1) is a chemical compound with the molecular formula C5H11NO2S and a molecular weight of 155.17 g/mol. IUPAC name: (2S)-2-(15N)azanyl-4-(113C)methylsulfanyl(1,2,3,4-13C4)butanoic acid. InChIKey: FFEARJCKVFRZRR-XAFSXMPTSA-N.
| Molecular formula | C5H11NO2S |
|---|---|
| Molecular weight | 155.17 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-4-(113C)methylsulfanyl(1,2,3,4-13C4)butanoic acid |
| InChIKey | FFEARJCKVFRZRR-XAFSXMPTSA-N |
| SMILES | [13CH3]S[13CH2][13CH2][13C@@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)