CAS 202524-90-1 is the registry number for (S)-4-Ethyl-3,6,10-trioxo-3,4,6,7,8,10-hexahydro-1H-pyrano[3,4-f]indolizin-4-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(4S)-4-ethyl-3,6,10-trioxo-7,8-dihydro-1H-pyrano[3,4-f]indolizin-4-yl] acetate (CAS 202524-90-1) is a chemical compound with the molecular formula C15H15NO6 and a molecular weight of 305.28 g/mol. IUPAC name: [(4S)-4-ethyl-3,6,10-trioxo-7,8-dihydro-1H-pyrano[3,4-f]indolizin-4-yl] acetate. InChIKey: XGAOUPSDOOVLLF-HNNXBMFYSA-N.
| Molecular formula | C15H15NO6 |
|---|---|
| Molecular weight | 305.28 g/mol |
| IUPAC name | [(4S)-4-ethyl-3,6,10-trioxo-7,8-dihydro-1H-pyrano[3,4-f]indolizin-4-yl] acetate |
| InChIKey | XGAOUPSDOOVLLF-HNNXBMFYSA-N |
| SMILES | CC[C@@]1(C2=C(COC1=O)C(=O)N3CCC(=O)C3=C2)OC(=O)C |
Computed by PubChem (NCBI)