CAS 148528-45-4 is the registry number for Dimethyl 1-benzyl-3,4-dihydroxypyrrole-2,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Dimethyl 1-benzyl-3,4-dihydroxypyrrole-2,5-dicarboxylate (CAS 148528-45-4) is a chemical compound with the molecular formula C15H15NO6 and a molecular weight of 305.28 g/mol. IUPAC name: dimethyl 1-benzyl-3,4-dihydroxypyrrole-2,5-dicarboxylate. InChIKey: BWSGIPNBEQVHHN-UHFFFAOYSA-N.
| Molecular formula | C15H15NO6 |
|---|---|
| Molecular weight | 305.28 g/mol |
| IUPAC name | dimethyl 1-benzyl-3,4-dihydroxypyrrole-2,5-dicarboxylate |
| InChIKey | BWSGIPNBEQVHHN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(N1CC2=CC=CC=C2)C(=O)OC)O)O |
Computed by PubChem (NCBI)