CAS 131613-54-2 is the registry number for 2-(1-Carboxy-3-methyl-butyl)-1,3-dioxo-2,3-dihydro-1h-isoindole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-(1-carboxy-3-methylbutyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 131613-54-2) is a chemical compound with the molecular formula C15H15NO6 and a molecular weight of 305.28 g/mol. IUPAC name: 2-(1-carboxy-3-methylbutyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: MLBQKULJXDHKHT-UHFFFAOYSA-N.
| Molecular formula | C15H15NO6 |
|---|---|
| Molecular weight | 305.28 g/mol |
| IUPAC name | 2-(1-carboxy-3-methylbutyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | MLBQKULJXDHKHT-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)N1C(=O)C2=C(C1=O)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)