CAS 230631-82-0 is the registry number for Methyl 4-((2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate (CAS 230631-82-0) is a chemical compound with the molecular formula C15H15NO6 and a molecular weight of 305.28 g/mol. IUPAC name: methyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate. InChIKey: VEBQALCYLIZIFD-UHFFFAOYSA-N.
| Molecular formula | C15H15NO6 |
|---|---|
| Molecular weight | 305.28 g/mol |
| IUPAC name | methyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate |
| InChIKey | VEBQALCYLIZIFD-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CNC2=CC=C(C=C2)C(=O)OC)C(=O)O1)C |
Computed by PubChem (NCBI)