Products 185130-13-6
CAS 185130-13-6 is the registry number for 2-[(2,2-Dimethyl-4,6-dioxo-[1,3]dioxan-5-ylidenemethyl)-amino]-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate (CAS 185130-13-6) is a chemical compound with the molecular formula C15H15NO6 and a molecular weight of 305.28 g/mol. IUPAC name: methyl 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate. InChIKey: ZWEQGBYLZYNDNT-UHFFFAOYSA-N.
| Molecular formula | C15H15NO6 |
|---|---|
| Molecular weight | 305.28 g/mol |
| IUPAC name | methyl 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate |
| InChIKey | ZWEQGBYLZYNDNT-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CNC2=CC=CC=C2C(=O)OC)C(=O)O1)C |
Computed by PubChem (NCBI)