Products 20266-25-5
CAS 20266-25-5 appears in our catalog under these names: 4-[(2-Chlorophenyl)amino]-4-oxobutanoic acid, 95%, 4-((2-Chlorophenyl)amino)-4-oxobutanoic acid, 97%, 4-((2-Chlorophenyl)amino)-4-oxobutanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 0,5g, 50mg.
4-(2-chloroanilino)-4-oxobutanoic acid (CAS 20266-25-5) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: 4-(2-chloroanilino)-4-oxobutanoic acid. InChIKey: GWHPLVIIGOTUJS-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3 |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | 4-(2-chloroanilino)-4-oxobutanoic acid |
| InChIKey | GWHPLVIIGOTUJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CCC(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-[(2-chlorophenyl)amino]-4-oxobutanoic acid, 3-[(2-chlorophenyl)carbamoyl]propanoic Acid, 4-(2-chloroanilino)-4-oxobutanoic acid, 4-((2-chlorophenyl)amino)-4-oxobutanoic acid, Oprea1_053203, Oprea1_847096, N-(2-Chlorophenyl)succinamic acid, 4-(2-chloroanilino)-4-oxo-butanoic acid, 3-(N-o-chlorophenylcarbamoyl)propionic acid, 3-[N-(2-chlorophenyl)carbamoyl]propanoic acid