Products 20270-53-5
CAS 20270-53-5 appears in our catalog under these names: Hexanedioic acid bis(1,1-dimethylethyl) ester, 95%, Di–tert–butyl adipate, Hexanedioic acid bis(1,1-dimethylethyl) ester, 99%+(GC-MS),RG, 99%+(GC-MS),RG, Di-tert-butyl adipate, Di-tert-butyl adipate, 95%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, Get quote.
Ditert-butyl hexanedioate (CAS 20270-53-5) is a chemical compound with the molecular formula C14H26O4 and a molecular weight of 258.35 g/mol. IUPAC name: ditert-butyl hexanedioate. InChIKey: QSVAYRBPFFOQMK-UHFFFAOYSA-N.
| Molecular formula | C14H26O4 |
|---|---|
| Molecular weight | 258.35 g/mol |
| IUPAC name | ditert-butyl hexanedioate |
| InChIKey | QSVAYRBPFFOQMK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)