Products 818-04-2
CAS 818-04-2 appears in our catalog under these names: Diisopentyl succinate, 95%, Diisopentyl succinate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Bis(3-methylbutyl) butanedioate (CAS 818-04-2) is a chemical compound with the molecular formula C14H26O4 and a molecular weight of 258.35 g/mol. IUPAC name: bis(3-methylbutyl) butanedioate. InChIKey: VITLQDOBPXWZLH-UHFFFAOYSA-N.
| Molecular formula | C14H26O4 |
|---|---|
| Molecular weight | 258.35 g/mol |
| IUPAC name | bis(3-methylbutyl) butanedioate |
| InChIKey | VITLQDOBPXWZLH-UHFFFAOYSA-N |
| SMILES | CC(C)CCOC(=O)CCC(=O)OCCC(C)C |
Computed by PubChem (NCBI)
Synonyms:
Diisopentyl succinate, diisoamyl succinate, Butanedioic acid, bis(3-methylbutyl) ester, bis(3-methylbutyl) butanedioate, diisopentyl butanedioate, Butanedioic acid,1,4-bis(3-methylbutyl) ester, Succinic acid, diisopentyl ester, Succinic acid, di(3-methylbutyl) ester, butanedioic acid bis-(3-methylbutyl) ester, Butanedioic acid, 1,4-bis(3-methylbutyl) ester