Products 4337-65-9
CAS 4337-65-9 appears in our catalog under these names: 2-Ethylhexyl hydrogen adipate, 95%, Mono-2-ethylhexyl adipate, >95% (GC), 2–ethylhexyl hydrogen adipate, 2-ethylhexyl hydrogen adipate, 97%, 6-((2-Ethylhexyl)oxy)-6-oxohexanoic acid, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 50mg.
6-(2-ethylhexoxy)-6-oxohexanoic acid (CAS 4337-65-9) is a chemical compound with the molecular formula C14H26O4 and a molecular weight of 258.35 g/mol. IUPAC name: 6-(2-ethylhexoxy)-6-oxohexanoic acid. InChIKey: MBGYSHXGENGTBP-UHFFFAOYSA-N.
| Molecular formula | C14H26O4 |
|---|---|
| Molecular weight | 258.35 g/mol |
| IUPAC name | 6-(2-ethylhexoxy)-6-oxohexanoic acid |
| InChIKey | MBGYSHXGENGTBP-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)CCCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Ethylhexyl hydrogen adipate, Mono(2-ethylhexyl) adipate, 2-ethylhexyl adipate, Mono-2-ethylhexyl adipate, Hexanedioic acid, mono(2-ethylhexyl) ester, 6-((2-Ethylhexyl)oxy)-6-oxohexanoic acid, 6-[(2-Ethylhexyl)oxy]-6-oxohexanoic acid, Mono2ethylhexyl adipate, 2Ethylhexyl hydrogen adipate, Mono(2ethylhexyl) hexanedioate