Products 959275-41-3
CAS 959275-41-3 appears in our catalog under these names: Isobutyl octyl oxalate, 95%, Isobutyl octan–2–yl oxalate, 1-(2-Methylpropyl) 2-octyl ethanedioate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 50mg.
2-O-(2-methylpropyl) 1-O-octyl oxalate (CAS 959275-41-3) is a chemical compound with the molecular formula C14H26O4 and a molecular weight of 258.35 g/mol. IUPAC name: 2-O-(2-methylpropyl) 1-O-octyl oxalate. InChIKey: UPSIDEFNJCYUBF-UHFFFAOYSA-N.
| Molecular formula | C14H26O4 |
|---|---|
| Molecular weight | 258.35 g/mol |
| IUPAC name | 2-O-(2-methylpropyl) 1-O-octyl oxalate |
| InChIKey | UPSIDEFNJCYUBF-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)C(=O)OCC(C)C |
Computed by PubChem (NCBI)