CAS 2027538-58-3 is the registry number for 6-Bromo-2-methyl-2,3-dihydrobenzo(d)isothiazole 1,1-dioxide, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
6-bromo-2-methyl-3H-1,2-benzothiazole 1,1-dioxide (CAS 2027538-58-3) is a chemical compound with the molecular formula C8H8BrNO2S and a molecular weight of 262.13 g/mol. IUPAC name: 6-bromo-2-methyl-3H-1,2-benzothiazole 1,1-dioxide. InChIKey: XDXHAOHQUBLABA-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2S |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | 6-bromo-2-methyl-3H-1,2-benzothiazole 1,1-dioxide |
| InChIKey | XDXHAOHQUBLABA-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(S1(=O)=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)