Products 1220422-12-7
CAS 1220422-12-7 is the registry number for Methyl 5-bromo-2-(methylsulfanyl)pyridine-3-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl 5-bromo-2-methylsulfanylpyridine-3-carboxylate (CAS 1220422-12-7) is a chemical compound with the molecular formula C8H8BrNO2S and a molecular weight of 262.13 g/mol. IUPAC name: methyl 5-bromo-2-methylsulfanylpyridine-3-carboxylate. InChIKey: FFKOQOWUJKHKAM-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2S |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | methyl 5-bromo-2-methylsulfanylpyridine-3-carboxylate |
| InChIKey | FFKOQOWUJKHKAM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)Br)SC |
Computed by PubChem (NCBI)