CAS 2090266-19-4 appears in our catalog under these names: 6-Amino-7-bromo-2,3-dihydrobenzo(b)thiophene 1,1-dioxide, 95%, 7-​Bromo-​2,​3-​dihydro-​benzo(b)​thiophen-​6-​amine 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-bromo-1,1-dioxo-2,3-dihydro-1-benzothiophen-6-amine (CAS 2090266-19-4) is a chemical compound with the molecular formula C8H8BrNO2S and a molecular weight of 262.13 g/mol. IUPAC name: 7-bromo-1,1-dioxo-2,3-dihydro-1-benzothiophen-6-amine. InChIKey: RGLJRDKNNQWMOX-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2S |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | 7-bromo-1,1-dioxo-2,3-dihydro-1-benzothiophen-6-amine |
| InChIKey | RGLJRDKNNQWMOX-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C1C=CC(=C2Br)N |
Computed by PubChem (NCBI)