CAS 2872505-87-6 is the registry number for 6-Bromo-3,4-dihydro-1H-benzo[d][1,2]thiazine 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-3,4-dihydro-1H-2lambda6,3-benzothiazine 2,2-dioxide (CAS 2872505-87-6) is a chemical compound with the molecular formula C8H8BrNO2S and a molecular weight of 262.13 g/mol. IUPAC name: 6-bromo-3,4-dihydro-1H-2lambda6,3-benzothiazine 2,2-dioxide. InChIKey: FUIRLABLYUIMTA-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2S |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | 6-bromo-3,4-dihydro-1H-2lambda6,3-benzothiazine 2,2-dioxide |
| InChIKey | FUIRLABLYUIMTA-UHFFFAOYSA-N |
| SMILES | C1C2=C(CS(=O)(=O)N1)C=CC(=C2)Br |
Computed by PubChem (NCBI)