Products 1857366-13-2

CAS 1857366-13-2 is the registry number for 5-Bromo-3-(ethylthio)picolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-bromo-3-ethylsulfanylpyridine-2-carboxylic acid (CAS 1857366-13-2) is a chemical compound with the molecular formula C8H8BrNO2S and a molecular weight of 262.13 g/mol. IUPAC name: 5-bromo-3-ethylsulfanylpyridine-2-carboxylic acid. InChIKey: HJPGREYRIMTZOQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrNO2S
Molecular weight262.13 g/mol
IUPAC name5-bromo-3-ethylsulfanylpyridine-2-carboxylic acid
InChIKeyHJPGREYRIMTZOQ-UHFFFAOYSA-N
SMILESCCSC1=C(N=CC(=C1)Br)C(=O)O

Computed by PubChem (NCBI)