CAS 2031259-05-7 is the registry number for 1-(2-Bromopyridin-3-yl)piperidin-2-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(2-bromo-3-pyridinyl)piperidin-2-one (CAS 2031259-05-7) is a chemical compound with the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. IUPAC name: 1-(2-bromo-3-pyridinyl)piperidin-2-one. InChIKey: IRGWFFGDWFMFLT-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 1-(2-bromo-3-pyridinyl)piperidin-2-one |
| InChIKey | IRGWFFGDWFMFLT-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=C(N=CC=C2)Br |
Computed by PubChem (NCBI)