Products 2031268-90-1
CAS 2031268-90-1 is the registry number for (7-Chloronaphthalen-2-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(7-chloronaphthalen-2-yl)methanamine;hydrochloride (CAS 2031268-90-1) is a chemical compound with the molecular formula C11H11Cl2N and a molecular weight of 228.11 g/mol. IUPAC name: (7-chloronaphthalen-2-yl)methanamine;hydrochloride. InChIKey: PJAPBXXIFXQAFJ-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N |
|---|---|
| Molecular weight | 228.11 g/mol |
| IUPAC name | (7-chloronaphthalen-2-yl)methanamine;hydrochloride |
| InChIKey | PJAPBXXIFXQAFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)Cl)CN.Cl |
Computed by PubChem (NCBI)