Products 2768875-80-3
CAS 2768875-80-3 is the registry number for 2,4-Dichloro-3-methyl-5,6,7,8-tetrahydro-5,8-methanoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-5-methyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (CAS 2768875-80-3) is a chemical compound with the molecular formula C11H11Cl2N and a molecular weight of 228.11 g/mol. IUPAC name: 4,6-dichloro-5-methyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene. InChIKey: STEWNULDXDVRNV-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N |
|---|---|
| Molecular weight | 228.11 g/mol |
| IUPAC name | 4,6-dichloro-5-methyl-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| InChIKey | STEWNULDXDVRNV-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C3CCC2C3)N=C1Cl)Cl |
Computed by PubChem (NCBI)