CAS 410074-73-6 is the registry number for Amitifadine. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 50mg, 10mg, 5mg, 25mg, Get quote.
(1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane (CAS 410074-73-6) is a chemical compound with the molecular formula C11H11Cl2N and a molecular weight of 228.11 g/mol. IUPAC name: (1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane. InChIKey: BSMNRYCSBFHEMQ-KCJUWKMLSA-N.
| Molecular formula | C11H11Cl2N |
|---|---|
| Molecular weight | 228.11 g/mol |
| IUPAC name | (1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane |
| InChIKey | BSMNRYCSBFHEMQ-KCJUWKMLSA-N |
| SMILES | C1[C@H]2[C@@]1(CNC2)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)