CAS 410074-75-8 is the registry number for DOV-102,677. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,5R)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane (CAS 410074-75-8) is a chemical compound with the molecular formula C11H11Cl2N and a molecular weight of 228.11 g/mol. IUPAC name: (1S,5R)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane. InChIKey: BSMNRYCSBFHEMQ-GZMMTYOYSA-N.
| Molecular formula | C11H11Cl2N |
|---|---|
| Molecular weight | 228.11 g/mol |
| IUPAC name | (1S,5R)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane |
| InChIKey | BSMNRYCSBFHEMQ-GZMMTYOYSA-N |
| SMILES | C1[C@@H]2[C@]1(CNC2)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)