CAS 20320-43-8 appears in our catalog under these names: 2-[(Pyrrolidin-1-yl)carbonyl]benzoic acid, 98%, 2-(Pyrrolidine-1-carbonyl)benzoic acid, 98%, 2-(1-Pyrrolidinylcarbonyl)benzoic acid, 2-[(Pyrrolidin-1-yl)carbonyl]benzoic acid, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 500mg.
2-(pyrrolidine-1-carbonyl)benzoic acid (CAS 20320-43-8) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 2-(pyrrolidine-1-carbonyl)benzoic acid. InChIKey: QCEUWPGTKKABMR-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 2-(pyrrolidine-1-carbonyl)benzoic acid |
| InChIKey | QCEUWPGTKKABMR-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)