Products 2034207-82-2

CAS 2034207-82-2 is the registry number for 1-Pyrrolidineethanamine, beta-methyl-, ethanedioate, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.

Oxalic acid;2-pyrrolidin-1-ylpropan-1-amine (CAS 2034207-82-2) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. IUPAC name: oxalic acid;2-pyrrolidin-1-ylpropan-1-amine. InChIKey: AKKMGNNVBBWCSU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18N2O4
Molecular weight218.25 g/mol
IUPAC nameoxalic acid;2-pyrrolidin-1-ylpropan-1-amine
InChIKeyAKKMGNNVBBWCSU-UHFFFAOYSA-N
SMILESCC(CN)N1CCCC1.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)