CAS 20357-15-7 appears in our catalog under these names: 1,2-Dimethylindole-3-carboxylic acid, 98%, 1,2-Dimethylindole-3-carboxylicacid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 1000mg, 2000mg, 5000mg.
1,2-dimethylindole-3-carboxylic acid (CAS 20357-15-7) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 1,2-dimethylindole-3-carboxylic acid. InChIKey: XYRXQPDMBJNYIU-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 1,2-dimethylindole-3-carboxylic acid |
| InChIKey | XYRXQPDMBJNYIU-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1C)C(=O)O |
Computed by PubChem (NCBI)