CAS 20367-33-3 is the registry number for Oxibendazole Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-nitro-4-propoxyphenyl)acetamide (CAS 20367-33-3) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: N-(2-nitro-4-propoxyphenyl)acetamide. InChIKey: SCCDPJHRMIEZGA-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | N-(2-nitro-4-propoxyphenyl)acetamide |
| InChIKey | SCCDPJHRMIEZGA-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC(=C(C=C1)NC(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)