CAS 20367-34-4 is the registry number for Oxibendazole Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
2-nitro-4-propoxyaniline (CAS 20367-34-4) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 2-nitro-4-propoxyaniline. InChIKey: VUMCVANUWQZNGD-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2-nitro-4-propoxyaniline |
| InChIKey | VUMCVANUWQZNGD-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC(=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)