Products 203805-84-9
CAS 203805-84-9 appears in our catalog under these names: L-Glutamic-2,4,4-d3 Acid, >95% (HPLC), L-Glutamic-2,4,4-d3 Acid, 98 atom % D, min 98% Chemical Purity, L–Glutamic acid–d3, L-Glutamic acid-d3, 99.26%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 5mg, 5 mg, 1 mg.
(2S)-2-amino-2,4,4-trideuteriopentanedioic acid (CAS 203805-84-9) is a chemical compound with the molecular formula C5H9NO4 and a molecular weight of 150.15 g/mol. IUPAC name: (2S)-2-amino-2,4,4-trideuteriopentanedioic acid. InChIKey: WHUUTDBJXJRKMK-KLDZMTGISA-N.
| Molecular formula | C5H9NO4 |
|---|---|
| Molecular weight | 150.15 g/mol |
| IUPAC name | (2S)-2-amino-2,4,4-trideuteriopentanedioic acid |
| InChIKey | WHUUTDBJXJRKMK-KLDZMTGISA-N |
| SMILES | [2H][C@](CC([2H])([2H])C(=O)O)(C(=O)O)N |
Computed by PubChem (NCBI)