Products 204187-39-3
CAS 204187-39-3 is the registry number for Mitiglinide Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate (CAS 204187-39-3) is a chemical compound with the molecular formula C20H27NO3 and a molecular weight of 329.4 g/mol. IUPAC name: methyl (2S)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate. InChIKey: AOVDRCINQFAUAA-KSZLIROESA-N.
| Molecular formula | C20H27NO3 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | methyl (2S)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate |
| InChIKey | AOVDRCINQFAUAA-KSZLIROESA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=CC=C1)CC(=O)N2C[C@H]3CCCC[C@H]3C2 |
Computed by PubChem (NCBI)