Products 2042346-34-7
CAS 2042346-34-7 appears in our catalog under these names: (R)-4-(tert-Butoxy)-2-hydroxy-4-oxobutanoic acid, 95%, (2R)-4-(tert-butoxy)-2-hydroxy-4-oxobutanoic acid, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-hydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 2042346-34-7) is a chemical compound with the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. IUPAC name: (2R)-2-hydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: ZNNDGDKLQUKDGI-RXMQYKEDSA-N.
| Molecular formula | C8H14O5 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (2R)-2-hydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | ZNNDGDKLQUKDGI-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H](C(=O)O)O |
Computed by PubChem (NCBI)