Products 204244-84-8
CAS 204244-84-8 appears in our catalog under these names: n-Hexyl-d13 Alcohol, 98 atom % D, min 98% Chemical Purity, 1-HEXAN-D13-OL, >=98 ATOM % D, >=99% CP, 1-Hexanol-d13, 99.47%. Offered by: CDN, Sigma-Aldrich, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1G, 10 mg, 5 mg.
1,1,2,2,3,3,4,4,5,5,6,6,6-tridecadeuteriohexan-1-ol (CAS 204244-84-8) is a chemical compound with the molecular formula C6H14O and a molecular weight of 115.25 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecadeuteriohexan-1-ol. InChIKey: ZSIAUFGUXNUGDI-UTBWLCBWSA-N.
| Molecular formula | C6H14O |
|---|---|
| Molecular weight | 115.25 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecadeuteriohexan-1-ol |
| InChIKey | ZSIAUFGUXNUGDI-UTBWLCBWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)