CAS 70482-86-9 is the registry number for 1-Hexanol-d4. Offered by: TRC. Available pack sizes: 100mg.
3,3,4,4-tetradeuteriohexan-1-ol (CAS 70482-86-9) is a chemical compound with the molecular formula C6H14O and a molecular weight of 106.20 g/mol. IUPAC name: 3,3,4,4-tetradeuteriohexan-1-ol. InChIKey: ZSIAUFGUXNUGDI-KHORGVISSA-N.
| Molecular formula | C6H14O |
|---|---|
| Molecular weight | 106.20 g/mol |
| IUPAC name | 3,3,4,4-tetradeuteriohexan-1-ol |
| InChIKey | ZSIAUFGUXNUGDI-KHORGVISSA-N |
| SMILES | [2H]C([2H])(CC)C([2H])([2H])CCO |
Computed by PubChem (NCBI)