Products 2159-18-4
CAS 2159-18-4 appears in our catalog under these names: 1-Hexanol-d11, n-Hexyl-2,2,3,3,4,4,5,5,6,6,6-d11 Alcohol, 98 atom % D, min 98% Chemical Purity, 1–Hexanol–d11, 1-Hexanol-d11, 99.33%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 1g, 500mg, 0,5g, 10mg, 25mg, 5mg, 50mg.
2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexan-1-ol (CAS 2159-18-4) is a chemical compound with the molecular formula C6H14O and a molecular weight of 113.24 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexan-1-ol. InChIKey: ZSIAUFGUXNUGDI-GILSBCIXSA-N.
| Molecular formula | C6H14O |
|---|---|
| Molecular weight | 113.24 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexan-1-ol |
| InChIKey | ZSIAUFGUXNUGDI-GILSBCIXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])CO |
Computed by PubChem (NCBI)