Products 64118-18-9
CAS 64118-18-9 appears in our catalog under these names: n-Hexyl-5,5,6,6,6-d5 Alcohol, n-Hexyl-5,5,6,6,6-d5 Alcohol, 98 atom % D, min 98% Chemical Purity, 1-Hexanol-d5, 0.9936%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 1 mg, 5 mg, 10 mg.
5,5,6,6,6-pentadeuteriohexan-1-ol (CAS 64118-18-9) is a chemical compound with the molecular formula C6H14O and a molecular weight of 107.21 g/mol. IUPAC name: 5,5,6,6,6-pentadeuteriohexan-1-ol. InChIKey: ZSIAUFGUXNUGDI-ZBJDZAJPSA-N.
| Molecular formula | C6H14O |
|---|---|
| Molecular weight | 107.21 g/mol |
| IUPAC name | 5,5,6,6,6-pentadeuteriohexan-1-ol |
| InChIKey | ZSIAUFGUXNUGDI-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CCCCO |
Computed by PubChem (NCBI)