CAS 2043026-13-5 appears in our catalog under these names: Roxadustat-d5, Roxadustat–d5, Roxadustat-d5, 98.80%. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, MedChemExpress. Available pack sizes: on request, 25mg, 1mg, 1 mg.
2-[[4-hydroxy-1-methyl-7-(2,3,4,5,6-pentadeuteriophenoxy)isoquinoline-3-carbonyl]amino]acetic acid (CAS 2043026-13-5) is a chemical compound with the molecular formula C19H16N2O5 and a molecular weight of 357.4 g/mol. IUPAC name: 2-[[4-hydroxy-1-methyl-7-(2,3,4,5,6-pentadeuteriophenoxy)isoquinoline-3-carbonyl]amino]acetic acid. InChIKey: YOZBGTLTNGAVFU-VIQYUKPQSA-N.
| Molecular formula | C19H16N2O5 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 2-[[4-hydroxy-1-methyl-7-(2,3,4,5,6-pentadeuteriophenoxy)isoquinoline-3-carbonyl]amino]acetic acid |
| InChIKey | YOZBGTLTNGAVFU-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OC2=CC3=C(N=C(C(=C3C=C2)O)C(=O)NCC(=O)O)C)[2H])[2H] |
Computed by PubChem (NCBI)