Products 808118-34-5

CAS 808118-34-5 is the registry number for Roxadustat Impurity 55. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(4-hydroxy-1-methyl-6-phenoxyisoquinoline-3-carbonyl)amino]acetic acid (CAS 808118-34-5) is a chemical compound with the molecular formula C19H16N2O5 and a molecular weight of 352.3 g/mol. IUPAC name: 2-[(4-hydroxy-1-methyl-6-phenoxyisoquinoline-3-carbonyl)amino]acetic acid. InChIKey: ZLDYCVXVGXUSBB-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16N2O5
Molecular weight352.3 g/mol
IUPAC name2-[(4-hydroxy-1-methyl-6-phenoxyisoquinoline-3-carbonyl)amino]acetic acid
InChIKeyZLDYCVXVGXUSBB-UHFFFAOYSA-N
SMILESCC1=C2C=CC(=CC2=C(C(=N1)C(=O)NCC(=O)O)O)OC3=CC=CC=C3

Computed by PubChem (NCBI)