CAS 808118-34-5 is the registry number for Roxadustat Impurity 55. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-hydroxy-1-methyl-6-phenoxyisoquinoline-3-carbonyl)amino]acetic acid (CAS 808118-34-5) is a chemical compound with the molecular formula C19H16N2O5 and a molecular weight of 352.3 g/mol. IUPAC name: 2-[(4-hydroxy-1-methyl-6-phenoxyisoquinoline-3-carbonyl)amino]acetic acid. InChIKey: ZLDYCVXVGXUSBB-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O5 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | 2-[(4-hydroxy-1-methyl-6-phenoxyisoquinoline-3-carbonyl)amino]acetic acid |
| InChIKey | ZLDYCVXVGXUSBB-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=CC2=C(C(=N1)C(=O)NCC(=O)O)O)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)