Products 340212-06-8
CAS 340212-06-8 is the registry number for ethyl 3-(4-((4'-nitrobenzyloxy)phenyl)prop-2-enoate-2-nitrile. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl 2-cyano-3-[4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoate (CAS 340212-06-8) is a chemical compound with the molecular formula C19H16N2O5 and a molecular weight of 352.3 g/mol. IUPAC name: ethyl 2-cyano-3-[4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoate. InChIKey: UGSIUJIZQWDRTQ-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O5 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | ethyl 2-cyano-3-[4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enoate |
| InChIKey | UGSIUJIZQWDRTQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CC1=CC=C(C=C1)OCC2=CC=C(C=C2)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)