CAS 20434-72-4 is the registry number for 4-Phenyl-2h-1,2,3-benzothiadiazine 1,1-dioxide, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-phenyl-2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide (CAS 20434-72-4) is a chemical compound with the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. IUPAC name: 4-phenyl-2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide. InChIKey: SUDHWWVNRMNJHL-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 4-phenyl-2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide |
| InChIKey | SUDHWWVNRMNJHL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNS(=O)(=O)C3=CC=CC=C32 |
Computed by PubChem (NCBI)