Products 20434-72-4

CAS 20434-72-4 is the registry number for 4-Phenyl-2h-1,2,3-benzothiadiazine 1,1-dioxide, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-phenyl-2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide (CAS 20434-72-4) is a chemical compound with the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. IUPAC name: 4-phenyl-2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide. InChIKey: SUDHWWVNRMNJHL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10N2O2S
Molecular weight258.30 g/mol
IUPAC name4-phenyl-2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide
InChIKeySUDHWWVNRMNJHL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NNS(=O)(=O)C3=CC=CC=C32

Computed by PubChem (NCBI)