CAS 225385-22-8 appears in our catalog under these names: 6-(4-Methoxyphenyl)-3h,4h-thieno[3,2-d]pyrimidin-4-one, 95%, 6-(4-Methoxyphenyl)-3H,4H-thieno(3,2-d)pyrimidin-4-one, 98%, 6-(4-Methoxyphenyl)-3H,4H-thieno(3,2-d)pyrimidin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
6-(4-methoxyphenyl)-3H-thieno[3,2-d]pyrimidin-4-one (CAS 225385-22-8) is a chemical compound with the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. IUPAC name: 6-(4-methoxyphenyl)-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: YLBLDEDUUJNEOU-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 6-(4-methoxyphenyl)-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | YLBLDEDUUJNEOU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC3=C(S2)C(=O)NC=N3 |
Computed by PubChem (NCBI)