Products 867034-27-3
CAS 867034-27-3 appears in our catalog under these names: 1-(Phenylsulfonyl)-1h-pyrrolo[2,3-c]pyridine, 98%, 1-(Phenylsulfonyl)-1H-pyrrolo(2,3-c)pyridine, 98%, 1–(benzenesulfonyl)–1H–pyrrolo(2，3–c)pyridine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 10g, 25g, 250mg, 1g.
1-(benzenesulfonyl)pyrrolo[2,3-c]pyridine (CAS 867034-27-3) is a chemical compound with the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. IUPAC name: 1-(benzenesulfonyl)pyrrolo[2,3-c]pyridine. InChIKey: OFEJGFIYSBWASK-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 1-(benzenesulfonyl)pyrrolo[2,3-c]pyridine |
| InChIKey | OFEJGFIYSBWASK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2C=NC=C3 |
Computed by PubChem (NCBI)