CAS 250258-56-1 appears in our catalog under these names: 2-[2-(1,3-Thiazol-4-yl)ethyl]-1h-isoindole-1,3(2h)-dione, 95%, 2-(2-(1,3-THiazol-4-yl)ethyl)-1h-isoindole-1,3(2h)-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-[2-(1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione (CAS 250258-56-1) is a chemical compound with the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. IUPAC name: 2-[2-(1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione. InChIKey: BOSVYXCOEKBACV-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 2-[2-(1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione |
| InChIKey | BOSVYXCOEKBACV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCC3=CSC=N3 |
Computed by PubChem (NCBI)