CAS 20445-31-2 appears in our catalog under these names: (R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid, 97%, (R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid, 97%, 97%, (R)-(+)-Alpha-methoxy-alpha-trifluoromethylphenylacetic acid, 98%, (R)–(+)–α–Methoxy–α–(trifluoromethyl)phenylacetic Acid, (R)-(+)-^a-Methoxy-^a-(trifluoromethyl)phenylacetic acid, 99. Offered by: Ambeed, Chemat, Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 10g, 0.1g.
(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid (CAS 20445-31-2) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid. InChIKey: JJYKJUXBWFATTE-SECBINFHSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid |
| InChIKey | JJYKJUXBWFATTE-SECBINFHSA-N |
| SMILES | CO[C@](C1=CC=CC=C1)(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)