CAS 2044712-87-8 appears in our catalog under these names: Ethyl 2-amino-4-(difluoromethyl)-1,3-oxazole-5-carboxylate, 95%, Ethyl 2-amino-4-(difluoromethyl)-1,3-oxazole-5-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Ethyl 2-amino-4-(difluoromethyl)-1,3-oxazole-5-carboxylate (CAS 2044712-87-8) is a chemical compound with the molecular formula C7H8F2N2O3 and a molecular weight of 206.15 g/mol. IUPAC name: ethyl 2-amino-4-(difluoromethyl)-1,3-oxazole-5-carboxylate. InChIKey: KTDPYJBYVHHHRI-UHFFFAOYSA-N.
| Molecular formula | C7H8F2N2O3 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | ethyl 2-amino-4-(difluoromethyl)-1,3-oxazole-5-carboxylate |
| InChIKey | KTDPYJBYVHHHRI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(O1)N)C(F)F |
Computed by PubChem (NCBI)