CAS 2111794-46-6 is the registry number for 5-(2,2-Difluoroethoxy)-1-methyl-1H-pyrazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,2-difluoroethoxy)-1-methylpyrazole-3-carboxylic acid (CAS 2111794-46-6) is a chemical compound with the molecular formula C7H8F2N2O3 and a molecular weight of 206.15 g/mol. IUPAC name: 5-(2,2-difluoroethoxy)-1-methylpyrazole-3-carboxylic acid. InChIKey: XFFLLZUVOGSMBA-UHFFFAOYSA-N.
| Molecular formula | C7H8F2N2O3 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 5-(2,2-difluoroethoxy)-1-methylpyrazole-3-carboxylic acid |
| InChIKey | XFFLLZUVOGSMBA-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)O)OCC(F)F |
Computed by PubChem (NCBI)