Products 2821785-86-6

CAS 2821785-86-6 is the registry number for 3-((Difluoromethoxy)methyl)-1-methyl-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(difluoromethoxymethyl)-1-methylpyrazole-5-carboxylic acid (CAS 2821785-86-6) is a chemical compound with the molecular formula C7H8F2N2O3 and a molecular weight of 206.15 g/mol. IUPAC name: 3-(difluoromethoxymethyl)-1-methylpyrazole-5-carboxylic acid. InChIKey: FIFYETCNVWOQNK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8F2N2O3
Molecular weight206.15 g/mol
IUPAC name3-(difluoromethoxymethyl)-1-methylpyrazole-5-carboxylic acid
InChIKeyFIFYETCNVWOQNK-UHFFFAOYSA-N
SMILESCN1C(=CC(=N1)COC(F)F)C(=O)O

Computed by PubChem (NCBI)