Products 2059942-03-7

CAS 2059942-03-7 is the registry number for Methyl 3-(5-(difluoromethyl)-1,3,4-oxadiazol-2-yl)propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]propanoate (CAS 2059942-03-7) is a chemical compound with the molecular formula C7H8F2N2O3 and a molecular weight of 206.15 g/mol. IUPAC name: methyl 3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]propanoate. InChIKey: JSVVTQMVICLGDL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8F2N2O3
Molecular weight206.15 g/mol
IUPAC namemethyl 3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]propanoate
InChIKeyJSVVTQMVICLGDL-UHFFFAOYSA-N
SMILESCOC(=O)CCC1=NN=C(O1)C(F)F

Computed by PubChem (NCBI)