CAS 2044713-63-3 is the registry number for 3-(5-Carbamoyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)propanoic acid (CAS 2044713-63-3) is a chemical compound with the molecular formula C8H9N3O5 and a molecular weight of 227.17 g/mol. IUPAC name: 3-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)propanoic acid. InChIKey: OAXBOGYHWRIZEN-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O5 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 3-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)propanoic acid |
| InChIKey | OAXBOGYHWRIZEN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1CCC(=O)O)C(=O)N |
Computed by PubChem (NCBI)