Products 2044713-63-3

CAS 2044713-63-3 is the registry number for 3-(5-Carbamoyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

3-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)propanoic acid (CAS 2044713-63-3) is a chemical compound with the molecular formula C8H9N3O5 and a molecular weight of 227.17 g/mol. IUPAC name: 3-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)propanoic acid. InChIKey: OAXBOGYHWRIZEN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9N3O5
Molecular weight227.17 g/mol
IUPAC name3-(5-carbamoyl-2,4-dioxopyrimidin-1-yl)propanoic acid
InChIKeyOAXBOGYHWRIZEN-UHFFFAOYSA-N
SMILESC1=C(C(=O)NC(=O)N1CCC(=O)O)C(=O)N

Computed by PubChem (NCBI)